Boronic acid, B-(4-chloro-2-fluorophenyl)-
| CAS No.: | 160591-91-3 |
| Catalog Number: | AG001S23 |
| Molecular Formula: | C6H5BClFO2 |
| Molecular Weight: | 174.3651 |
| MDL No.: | MFCD02684293 |
| Pack Size | Purity | Price(USD) | Availability |
|---|---|---|---|
| 250mg | 97% |
$
 |
out of stock |
| 1g | 97+% |
$
 |
out of stock |
| 5g | 97+% |
$
 |
out of stock |
| 10g | 97+% |
$
 |
out of stock |
| 25g | 97+% |
$
 |
out of stock |
| 100g | 97+% |
$
 |
out of stock |