Boronic acid, B-(4-chloro-3-fluorophenyl)-
| CAS No.: | 137504-86-0 |
| Catalog Number: | AG0013EC |
| Molecular Formula: | C6H5BClFO2 |
| Molecular Weight: | 174.3651 |
| MDL No.: | MFCD01319010 |
| Pack Size | Purity | Price(USD) | Availability |
|---|---|---|---|
| 250mg | 98% |
$
 |
out of stock |
| 1g | 97+% |
$
 |
out of stock |
| 5g | 97+% |
$
 |
out of stock |
| 10g | 97+% |
$
 |
out of stock |
| 25g | 97+% |
$
 |
out of stock |
| 100g | 98% |
$
 |
out of stock |